C16H11N3OSSe — CID 70689763
2-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]-1,2-benzoselenazol-3-one (PubChem CID 70689763) has the molecular formula C16H11N3OSSe and a molecular weight of 372.31 g/mol. Its IUPAC name is 2-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]-1,2-benzoselenazol-3-one.
| Compound Name | 2-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 70689763 |
| Molecular Formula | C16H11N3OSSe |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 2-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]-1,2-benzoselenazol-3-one |
| SMILES | Cc1ccccc1-c1nnc(-n2[se]c3ccccc3c2=O)s1 |
| InChI | InChI=1S/C16H11N3OSSe/c1-10-6-2-3-7-11(10)14-17-18-16(21-14)19-15(20)12-8-4-5-9-13(12)22-19/h2-9H,1H3 |
| InChIKey | AUJYJCFURGCVHH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|