C35H38NO5P — CID 70690009
(2S,3S,4S,5S,6R)-2-oxo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-N-prop-2-enyl-1,2λ5-oxaphosphinan-3-amine (PubChem CID 70690009) has the molecular formula C35H38NO5P and a molecular weight of 583.67 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-2-oxo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-N-prop-2-enyl-1,2λ5-oxaphosphinan-3-amine.
| Compound Name | (2S,3S,4S,5S,6R)-2-oxo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-N-prop-2-enyl-1,2λ5-oxaphosphinan-3-amine |
|---|---|
| PubChem CID | 70690009 |
| Molecular Formula | C35H38NO5P |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-oxo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-N-prop-2-enyl-1,2λ5-oxaphosphinan-3-amine |
| SMILES | C=CCN[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[P@@]1(=O)c1ccccc1 |
| InChI | InChI=1S/C35H38NO5P/c1-2-23-36-35-34(40-26-30-19-11-5-12-20-30)33(39-25-29-17-9-4-10-18-29)32(27-38-24-28-15-7-3-8-16-28)41-42(35,37)31-21-13-6-14-22-31/h2-22,32-36H,1,23-27H2/t32-,33-,34+,35+,42+/m1/s1 |
| InChIKey | CILAZGTYPHWCQA-JZLGGWOASA-N |
| XLogP | 6.48 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|