C19H41NO2 — CID 70690151
(2S,3R,5S)-2-(methylamino)octadecane-3,5-diol (PubChem CID 70690151) has the molecular formula C19H41NO2 and a molecular weight of 315.54 g/mol. Its IUPAC name is (2S,3R,5S)-2-(methylamino)octadecane-3,5-diol.
| Compound Name | (2S,3R,5S)-2-(methylamino)octadecane-3,5-diol |
|---|---|
| PubChem CID | 70690151 |
| Molecular Formula | C19H41NO2 |
| Molecular Weight | 315.54 g/mol |
| Exact Mass | 315.31 |
| IUPAC Name | (2S,3R,5S)-2-(methylamino)octadecane-3,5-diol |
| SMILES | CCCCCCCCCCCCC[C@H](O)C[C@@H](O)[C@H](C)NC |
| InChI | InChI=1S/C19H41NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-18(21)16-19(22)17(2)20-3/h17-22H,4-16H2,1-3H3/t17-,18-,19+/m0/s1 |
| InChIKey | IBEMSRLQXXZONA-GBESFXJTSA-N |
| XLogP | 4.41 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|