C24H30N2O5 — CID 70690222
(3S,5S)-4-benzyl-3-[(R)-hydroxy(phenyl)methyl]-1-(methoxymethoxy)-5-(2-methylpropyl)piperazine-2,6-dione (PubChem CID 70690222) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is (3S,5S)-4-benzyl-3-[(R)-hydroxy(phenyl)methyl]-1-(methoxymethoxy)-5-(2-methylpropyl)piperazine-2,6-dione.
| Compound Name | (3S,5S)-4-benzyl-3-[(R)-hydroxy(phenyl)methyl]-1-(methoxymethoxy)-5-(2-methylpropyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 70690222 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (3S,5S)-4-benzyl-3-[(R)-hydroxy(phenyl)methyl]-1-(methoxymethoxy)-5-(2-methylpropyl)piperazine-2,6-dione |
| SMILES | COCON1C(=O)[C@H]([C@H](O)c2ccccc2)N(Cc2ccccc2)[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C24H30N2O5/c1-17(2)14-20-23(28)26(31-16-30-3)24(29)21(22(27)19-12-8-5-9-13-19)25(20)15-18-10-6-4-7-11-18/h4-13,17,20-22,27H,14-16H2,1-3H3/t20-,21-,22+/m0/s1 |
| InChIKey | CNDWLASFZYYAJL-FDFHNCONSA-N |
| XLogP | 2.91 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|