C28H30N2O6 — CID 70690224
(3S,5S)-3,4-dibenzyl-5-[(R)-hydroxy-(4-methoxyphenyl)methyl]-1-(methoxymethoxy)piperazine-2,6-dione (PubChem CID 70690224) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is (3S,5S)-3,4-dibenzyl-5-[(R)-hydroxy-(4-methoxyphenyl)methyl]-1-(methoxymethoxy)piperazine-2,6-dione.
| Compound Name | (3S,5S)-3,4-dibenzyl-5-[(R)-hydroxy-(4-methoxyphenyl)methyl]-1-(methoxymethoxy)piperazine-2,6-dione |
|---|---|
| PubChem CID | 70690224 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | (3S,5S)-3,4-dibenzyl-5-[(R)-hydroxy-(4-methoxyphenyl)methyl]-1-(methoxymethoxy)piperazine-2,6-dione |
| SMILES | COCON1C(=O)[C@H]([C@H](O)c2ccc(OC)cc2)N(Cc2ccccc2)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H30N2O6/c1-34-19-36-30-27(32)24(17-20-9-5-3-6-10-20)29(18-21-11-7-4-8-12-21)25(28(30)33)26(31)22-13-15-23(35-2)16-14-22/h3-16,24-26,31H,17-19H2,1-2H3/t24-,25-,26+/m0/s1 |
| InChIKey | BQZWHRGWJOAALT-KKUQBAQOSA-N |
| XLogP | 3.12 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|