C27H34N2O5 — CID 70690377
(1S,4R)-5-[(3,5-dinitrophenyl)methoxy]-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 70690377) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is (1S,4R)-5-[(3,5-dinitrophenyl)methoxy]-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1S,4R)-5-[(3,5-dinitrophenyl)methoxy]-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 70690377 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (1S,4R)-5-[(3,5-dinitrophenyl)methoxy]-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)=CCC[C@H](C)[C@@H]1CC[C@@H](C)c2c(OCc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc(C)cc21 |
| InChI | InChI=1S/C27H34N2O5/c1-17(2)7-6-8-19(4)24-10-9-20(5)27-25(24)11-18(3)12-26(27)34-16-21-13-22(28(30)31)15-23(14-21)29(32)33/h7,11-15,19-20,24H,6,8-10,16H2,1-5H3/t19-,20+,24-/m0/s1 |
| InChIKey | JQQVABDLPXUDTD-ROKPMTFOSA-N |
| XLogP | 7.75 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|