About (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol
(6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol (PubChem CID 70690409) has the molecular formula C18H13BrN2O
and a molecular weight of 353.22 g/mol. Its IUPAC name is (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol.
Molecular Properties
| Compound Name | (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol |
| PubChem CID | 70690409 |
| Molecular Formula | C18H13BrN2O |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol |
| SMILES | OC(c1ccccc1)c1nccc2c1[nH]c1ccc(Br)cc12 |
| InChI | InChI=1S/C18H13BrN2O/c19-12-6-7-15-14(10-12)13-8-9-20-17(16(13)21-15)18(22)11-4-2-1-3-5-11/h1-10,18,21-22H |
| InChIKey | FUINDJPWTVFMGF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol?
The IUPAC name of (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol (CID 70690409) is (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol.
What is the SMILES notation for (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol?
The canonical SMILES for (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol is OC(c1ccccc1)c1nccc2c1[nH]c1ccc(Br)cc12.
What is the InChIKey of (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol?
The InChIKey is FUINDJPWTVFMGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrN2O/c19-12-6-7-15-14(10-12)13-8-9-20-17(16(13)21-15)18(22)11-4-2-1-3-5-11/h1-10,18,21-22H.
What are the key properties of (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol?
(6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol has a molecular weight of 353.22 g/mol, XLogP of 4.56, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-9H-pyrido[3,4-b]indol-1-yl)-phenylmethanol is sourced from PubChem (CID 70690409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).