C14H25NO8 — CID 70690487
(1S,2S,3R,6S)-6-[[(2R,3R,4S,5R,6S)-4,5-dihydroxy-6-methoxy-2-methyloxan-3-yl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 70690487) has the molecular formula C14H25NO8 and a molecular weight of 335.35 g/mol. Its IUPAC name is (1S,2S,3R,6S)-6-[[(2R,3R,4S,5R,6S)-4,5-dihydroxy-6-methoxy-2-methyloxan-3-yl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2S,3R,6S)-6-[[(2R,3R,4S,5R,6S)-4,5-dihydroxy-6-methoxy-2-methyloxan-3-yl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 70690487 |
| Molecular Formula | C14H25NO8 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (1S,2S,3R,6S)-6-[[(2R,3R,4S,5R,6S)-4,5-dihydroxy-6-methoxy-2-methyloxan-3-yl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | CO[C@H]1O[C@H](C)[C@H](N[C@H]2C=C(CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H25NO8/c1-5-8(11(19)13(21)14(22-2)23-5)15-7-3-6(4-16)9(17)12(20)10(7)18/h3,5,7-21H,4H2,1-2H3/t5-,7+,8+,9-,10+,11+,12+,13-,14+/m1/s1 |
| InChIKey | KFHKERRGDZTZQJ-UZYNFKIKSA-N |
| XLogP | -3.56 |
| TPSA | 151.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|