C11H10F3N3O2S2 — CID 70690664
[(E)-[1,1-dioxo-6-(trifluoromethyl)-2,3-dihydrothiochromen-4-ylidene]amino]thiourea (PubChem CID 70690664) has the molecular formula C11H10F3N3O2S2 and a molecular weight of 337.35 g/mol. Its IUPAC name is [(E)-[1,1-dioxo-6-(trifluoromethyl)-2,3-dihydrothiochromen-4-ylidene]amino]thiourea.
| Compound Name | [(E)-[1,1-dioxo-6-(trifluoromethyl)-2,3-dihydrothiochromen-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 70690664 |
| Molecular Formula | C11H10F3N3O2S2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | [(E)-[1,1-dioxo-6-(trifluoromethyl)-2,3-dihydrothiochromen-4-ylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C1\CCS(=O)(=O)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C11H10F3N3O2S2/c12-11(13,14)6-1-2-9-7(5-6)8(16-17-10(15)20)3-4-21(9,18)19/h1-2,5H,3-4H2,(H3,15,17,20)/b16-8+ |
| InChIKey | NVJNBEIYUZUTDT-LZYBPNLTSA-N |
| XLogP | 1.42 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|