C23H27NO4 — CID 70690752
(2S,3R,4S,5R)-2-[1-[(4-propylphenyl)methyl]indol-3-yl]oxane-3,4,5-triol (PubChem CID 70690752) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[1-[(4-propylphenyl)methyl]indol-3-yl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[1-[(4-propylphenyl)methyl]indol-3-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70690752 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (2S,3R,4S,5R)-2-[1-[(4-propylphenyl)methyl]indol-3-yl]oxane-3,4,5-triol |
| SMILES | CCCc1ccc(Cn2cc([C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-2-5-15-8-10-16(11-9-15)12-24-13-18(17-6-3-4-7-19(17)24)23-22(27)21(26)20(25)14-28-23/h3-4,6-11,13,20-23,25-27H,2,5,12,14H2,1H3/t20-,21+,22-,23+/m1/s1 |
| InChIKey | CWTQWNARRLXXPF-ACESQOTJSA-N |
| XLogP | 2.80 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |