C15H14ClN3O2 — CID 706908
(2S)-2-(4-chlorophenoxy)-N-(pyridin-4-ylmethylideneamino)propanamide (PubChem CID 706908) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenoxy)-N-(pyridin-4-ylmethylideneamino)propanamide.
| Compound Name | (2S)-2-(4-chlorophenoxy)-N-(pyridin-4-ylmethylideneamino)propanamide |
|---|---|
| PubChem CID | 706908 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (2S)-2-(4-chlorophenoxy)-N-(pyridin-4-ylmethylideneamino)propanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1)C(=O)NN=Cc1ccncc1 |
| InChI | InChI=1S/C15H14ClN3O2/c1-11(21-14-4-2-13(16)3-5-14)15(20)19-18-10-12-6-8-17-9-7-12/h2-11H,1H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | VQTDQYGVZQXHLG-NSHDSACASA-N |
| XLogP | 2.65 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|