C26H24F4N4O2 — CID 70690893
(3R)-3-amino-1-[4-[6-(4-fluorophenyl)pyridine-2-carbonyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 70690893) has the molecular formula C26H24F4N4O2 and a molecular weight of 500.50 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-[6-(4-fluorophenyl)pyridine-2-carbonyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[4-[6-(4-fluorophenyl)pyridine-2-carbonyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 70690893 |
| Molecular Formula | C26H24F4N4O2 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | (3R)-3-amino-1-[4-[6-(4-fluorophenyl)pyridine-2-carbonyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCN(C(=O)c2cccc(-c3ccc(F)cc3)n2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C26H24F4N4O2/c27-18-6-4-16(5-7-18)23-2-1-3-24(32-23)26(36)34-10-8-33(9-11-34)25(35)14-19(31)12-17-13-21(29)22(30)15-20(17)28/h1-7,13,15,19H,8-12,14,31H2/t19-/m1/s1 |
| InChIKey | CEUHNJVXCHXXJT-LJQANCHMSA-N |
| XLogP | 3.55 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|