C17H26O4 — CID 70690918
methyl 2-[(2S,4aR,5S,8aR)-5-hydroxy-4a-(hydroxymethyl)-7-methyl-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate (PubChem CID 70690918) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl 2-[(2S,4aR,5S,8aR)-5-hydroxy-4a-(hydroxymethyl)-7-methyl-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate.
| Compound Name | methyl 2-[(2S,4aR,5S,8aR)-5-hydroxy-4a-(hydroxymethyl)-7-methyl-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 70690918 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methyl 2-[(2S,4aR,5S,8aR)-5-hydroxy-4a-(hydroxymethyl)-7-methyl-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@@H]1C=C[C@@]2(CO)[C@@H](O)CC(C)=C[C@H]2C1 |
| InChI | InChI=1S/C17H26O4/c1-11-7-13-9-12(16(2,3)15(20)21-4)5-6-17(13,10-18)14(19)8-11/h5-7,12-14,18-19H,8-10H2,1-4H3/t12-,13+,14+,17+/m1/s1 |
| InChIKey | NVILRPFGVLEDHL-FHIRATQRSA-N |
| XLogP | 2.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|