C22H33NO4 — CID 70690934
(1R,4aR,4bS,7S,8aS,10aS)-7-cyano-1-ethoxycarbonyl-1,4a,7-trimethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-8a-carboxylic acid (PubChem CID 70690934) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is (1R,4aR,4bS,7S,8aS,10aS)-7-cyano-1-ethoxycarbonyl-1,4a,7-trimethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-8a-carboxylic acid.
| Compound Name | (1R,4aR,4bS,7S,8aS,10aS)-7-cyano-1-ethoxycarbonyl-1,4a,7-trimethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-8a-carboxylic acid |
|---|---|
| PubChem CID | 70690934 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (1R,4aR,4bS,7S,8aS,10aS)-7-cyano-1-ethoxycarbonyl-1,4a,7-trimethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-8a-carboxylic acid |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@](C)(C#N)C[C@@]3(C(=O)O)CC[C@@H]21 |
| InChI | InChI=1S/C22H33NO4/c1-5-27-18(26)21(4)10-6-9-20(3)15(21)8-12-22(17(24)25)13-19(2,14-23)11-7-16(20)22/h15-16H,5-13H2,1-4H3,(H,24,25)/t15-,16-,19-,20+,21+,22-/m0/s1 |
| InChIKey | VGRLEDCAGUSPEN-RHSMJXSCSA-N |
| XLogP | 4.56 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |