About 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol
1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol (PubChem CID 70691000) has the molecular formula C22H23ClF6O
and a molecular weight of 452.87 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol |
| PubChem CID | 70691000 |
| Molecular Formula | C22H23ClF6O |
| Molecular Weight | 452.87 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol |
| SMILES | CCCCCCCC(O)(c1cccc(Cl)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23ClF6O/c1-2-3-4-5-6-10-20(30,15-8-7-9-19(23)14-15)16-11-17(21(24,25)26)13-18(12-16)22(27,28)29/h7-9,11-14,30H,2-6,10H2,1H3 |
| InChIKey | XFQMBFHZWJPAFM-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.87 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol (CID 70691000) is 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol is CCCCCCCC(O)(c1cccc(Cl)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol?
The InChIKey is XFQMBFHZWJPAFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23ClF6O/c1-2-3-4-5-6-10-20(30,15-8-7-9-19(23)14-15)16-11-17(21(24,25)26)13-18(12-16)22(27,28)29/h7-9,11-14,30H,2-6,10H2,1H3.
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol?
1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol has a molecular weight of 452.87 g/mol, XLogP of 7.97, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)octan-1-ol is sourced from PubChem (CID 70691000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).