C19H20ClNO2 — CID 70691008
N-[1-(4-chlorophenyl)-3,3-dimethyl-1-oxobutan-2-yl]benzamide (PubChem CID 70691008) has the molecular formula C19H20ClNO2 and a molecular weight of 329.83 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-3,3-dimethyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[1-(4-chlorophenyl)-3,3-dimethyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 70691008 |
| Molecular Formula | C19H20ClNO2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[1-(4-chlorophenyl)-3,3-dimethyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)(C)C(NC(=O)c1ccccc1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO2/c1-19(2,3)17(16(22)13-9-11-15(20)12-10-13)21-18(23)14-7-5-4-6-8-14/h4-12,17H,1-3H3,(H,21,23) |
| InChIKey | OSRJLGOOPNGZRD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |