C24H16O3S3 — CID 70691170
2-hydroxy-3,5,6-tris(phenylsulfanyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 70691170) has the molecular formula C24H16O3S3 and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-hydroxy-3,5,6-tris(phenylsulfanyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-hydroxy-3,5,6-tris(phenylsulfanyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 70691170 |
| Molecular Formula | C24H16O3S3 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 2-hydroxy-3,5,6-tris(phenylsulfanyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C(O)=C(Sc2ccccc2)C(=O)C(Sc2ccccc2)=C1Sc1ccccc1 |
| InChI | InChI=1S/C24H16O3S3/c25-19-20(26)23(29-17-12-6-2-7-13-17)24(30-18-14-8-3-9-15-18)21(27)22(19)28-16-10-4-1-5-11-16/h1-15,25H |
| InChIKey | MRNZAJLCLJEEKB-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|