C20H29NaO2 — CID 70691188
sodium 3-[(1S,2S,6S,8aS)-6-ethenyl-1,6-dimethyl-2-prop-1-en-2-yl-2,3,5,7,8,8a-hexahydronaphthalen-1-yl]propanoate (PubChem CID 70691188) has the molecular formula C20H29NaO2 and a molecular weight of 324.44 g/mol. Its IUPAC name is sodium 3-[(1S,2S,6S,8aS)-6-ethenyl-1,6-dimethyl-2-prop-1-en-2-yl-2,3,5,7,8,8a-hexahydronaphthalen-1-yl]propanoate.
| Compound Name | sodium 3-[(1S,2S,6S,8aS)-6-ethenyl-1,6-dimethyl-2-prop-1-en-2-yl-2,3,5,7,8,8a-hexahydronaphthalen-1-yl]propanoate |
|---|---|
| PubChem CID | 70691188 |
| Molecular Formula | C20H29NaO2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | sodium 3-[(1S,2S,6S,8aS)-6-ethenyl-1,6-dimethyl-2-prop-1-en-2-yl-2,3,5,7,8,8a-hexahydronaphthalen-1-yl]propanoate |
| SMILES | C=C[C@@]1(C)CC[C@H]2C(=CC[C@@H](C(=C)C)[C@]2(C)CCC(=O)[O-])C1.[Na+] |
| InChI | InChI=1S/C20H30O2.Na/c1-6-19(4)11-9-17-15(13-19)7-8-16(14(2)3)20(17,5)12-10-18(21)22;/h6-7,16-17H,1-2,8-13H2,3-5H3,(H,21,22);/q;+1/p-1/t16-,17-,19-,20-;/m0./s1 |
| InChIKey | JKMGJBPIBGEAKS-SSKJIEBZSA-M |
| XLogP | 1.04 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|