C26H22Cl2N6OS — CID 70691194
N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-amine (PubChem CID 70691194) has the molecular formula C26H22Cl2N6OS and a molecular weight of 537.48 g/mol. Its IUPAC name is N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-amine.
| Compound Name | N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 70691194 |
| Molecular Formula | C26H22Cl2N6OS |
| Molecular Weight | 537.48 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-amine |
| SMILES | Clc1ccc(Cn2cc(/C=N/Nc3nc(N4CCOCC4)c4sccc4n3)c3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C26H22Cl2N6OS/c27-19-6-5-17(21(28)13-19)15-34-16-18(20-3-1-2-4-23(20)34)14-29-32-26-30-22-7-12-36-24(22)25(31-26)33-8-10-35-11-9-33/h1-7,12-14,16H,8-11,15H2,(H,30,31,32)/b29-14+ |
| InChIKey | BCCAEBZYXDRSSF-IPPBACCNSA-N |
| XLogP | 6.28 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|