1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid

C15H10N2O2 — CID 70691252

IUPAC1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid
SMILESO=C(O)c1cc2c3ccccc3[nH]c2c2[nH]ccc12
InChIInChI=1S/C15H10N2O2/c18-15(19)11-7-10-8-3-1-2-4-12(8)17-14(10)13-9(11)5-6-16-13/h1-7,16-17H,(H,18,19)
InChIKeyUTTLLHVBBKIZJB-UHFFFAOYSA-N
MW250.26 g/mol
LogP3.50
Rot. Bonds1

About 1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid

1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid (PubChem CID 70691252) has the molecular formula C15H10N2O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid.

Molecular Properties

Compound Name1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid
PubChem CID70691252
Molecular FormulaC15H10N2O2
Molecular Weight250.26 g/mol
Exact Mass250.07
IUPAC Name1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid
SMILESO=C(O)c1cc2c3ccccc3[nH]c2c2[nH]ccc12
InChIInChI=1S/C15H10N2O2/c18-15(19)11-7-10-8-3-1-2-4-12(8)17-14(10)13-9(11)5-6-16-13/h1-7,16-17H,(H,18,19)
InChIKeyUTTLLHVBBKIZJB-UHFFFAOYSA-N
XLogP3.50
TPSA68.88 Ų
H-Bond Donors3
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.26
LogP ≤ 53.50
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 101

Analyze 1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid?
The IUPAC name of 1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid (CID 70691252) is 1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid.
What is the SMILES notation for 1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid?
The canonical SMILES for 1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid is O=C(O)c1cc2c3ccccc3[nH]c2c2[nH]ccc12.
What is the InChIKey of 1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid?
The InChIKey is UTTLLHVBBKIZJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O2/c18-15(19)11-7-10-8-3-1-2-4-12(8)17-14(10)13-9(11)5-6-16-13/h1-7,16-17H,(H,18,19).
What are the key properties of 1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid?
1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid has a molecular weight of 250.26 g/mol, XLogP of 3.50, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10-dihydropyrrolo[2,3-a]carbazole-4-carboxylic acid is sourced from PubChem (CID 70691252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).