C19H23NO4S — CID 70691450
diethyl (1S,9R,13R)-9,11-dimethyl-8-thia-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12,13-dicarboxylate (PubChem CID 70691450) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is diethyl (1S,9R,13R)-9,11-dimethyl-8-thia-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12,13-dicarboxylate.
| Compound Name | diethyl (1S,9R,13R)-9,11-dimethyl-8-thia-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12,13-dicarboxylate |
|---|---|
| PubChem CID | 70691450 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | diethyl (1S,9R,13R)-9,11-dimethyl-8-thia-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12,13-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N[C@]2(C)Sc3ccccc3[C@H]1[C@@H]2C(=O)OCC |
| InChI | InChI=1S/C19H23NO4S/c1-5-23-17(21)14-11(3)20-19(4)16(18(22)24-6-2)15(14)12-9-7-8-10-13(12)25-19/h7-10,15-16,20H,5-6H2,1-4H3/t15-,16-,19-/m1/s1 |
| InChIKey | JRQKDYLMCZBENZ-GPMSIDNRSA-N |
| XLogP | 3.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |