C17H16O3S — CID 70691567
methyl 3-(1-benzothiophen-2-yl)-8-oxabicyclo[3.2.1]oct-2-ene-2-carboxylate (PubChem CID 70691567) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is methyl 3-(1-benzothiophen-2-yl)-8-oxabicyclo[3.2.1]oct-2-ene-2-carboxylate.
| Compound Name | methyl 3-(1-benzothiophen-2-yl)-8-oxabicyclo[3.2.1]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70691567 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | methyl 3-(1-benzothiophen-2-yl)-8-oxabicyclo[3.2.1]oct-2-ene-2-carboxylate |
| SMILES | COC(=O)C1=C(c2cc3ccccc3s2)CC2CCC1O2 |
| InChI | InChI=1S/C17H16O3S/c1-19-17(18)16-12(9-11-6-7-13(16)20-11)15-8-10-4-2-3-5-14(10)21-15/h2-5,8,11,13H,6-7,9H2,1H3 |
| InChIKey | SOIKHMSXRURTFX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |