C18H19Cl2N3O2 — CID 70691660
N-[(3,4-dichlorophenyl)methyl]-N'-(6-methoxy-1,3-benzoxazol-2-yl)propane-1,3-diamine (PubChem CID 70691660) has the molecular formula C18H19Cl2N3O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N'-(6-methoxy-1,3-benzoxazol-2-yl)propane-1,3-diamine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N'-(6-methoxy-1,3-benzoxazol-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 70691660 |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N'-(6-methoxy-1,3-benzoxazol-2-yl)propane-1,3-diamine |
| SMILES | COc1ccc2nc(NCCCNCc3ccc(Cl)c(Cl)c3)oc2c1 |
| InChI | InChI=1S/C18H19Cl2N3O2/c1-24-13-4-6-16-17(10-13)25-18(23-16)22-8-2-7-21-11-12-3-5-14(19)15(20)9-12/h3-6,9-10,21H,2,7-8,11H2,1H3,(H,22,23) |
| InChIKey | YWLUMBZFAISSSJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|