About tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium
tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium (PubChem CID 70691702) has the molecular formula C36H57NO2P+
and a molecular weight of 566.83 g/mol. Its IUPAC name is tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium.
Molecular Properties
| Compound Name | tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium |
| PubChem CID | 70691702 |
| Molecular Formula | C36H57NO2P+ |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.41 |
| IUPAC Name | tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCCCCC[P+](C1CCCCC1)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C36H57NO2P/c38-35-33-26-16-17-27-34(33)36(39)37(35)28-18-5-3-1-2-4-6-19-29-40(30-20-10-7-11-21-30,31-22-12-8-13-23-31)32-24-14-9-15-25-32/h16-17,26-27,30-32H,1-15,18-25,28-29H2/q+1 |
| InChIKey | NSUVHFPHJDYAEY-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium?
The IUPAC name of tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium (CID 70691702) is tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium.
What is the SMILES notation for tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium?
The canonical SMILES for tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium is O=C1c2ccccc2C(=O)N1CCCCCCCCCC[P+](C1CCCCC1)(C1CCCCC1)C1CCCCC1.
What is the InChIKey of tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium?
The InChIKey is NSUVHFPHJDYAEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H57NO2P/c38-35-33-26-16-17-27-34(33)36(39)37(35)28-18-5-3-1-2-4-6-19-29-40(30-20-10-7-11-21-30,31-22-12-8-13-23-31)32-24-14-9-15-25-32/h16-17,26-27,30-32H,1-15,18-25,28-29H2/q+1.
What are the key properties of tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium?
tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium has a molecular weight of 566.83 g/mol, XLogP of 10.42, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclohexyl-[10-(1,3-dioxoisoindol-2-yl)decyl]phosphanium is sourced from PubChem (CID 70691702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).