C16H20N2O — CID 7069204
(1R,13S)-13-methyl-2,6-diazatetracyclo[11.4.0.01,6.07,12]heptadeca-7,9,11-trien-3-one (PubChem CID 7069204) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (1R,13S)-13-methyl-2,6-diazatetracyclo[11.4.0.01,6.07,12]heptadeca-7,9,11-trien-3-one.
| Compound Name | (1R,13S)-13-methyl-2,6-diazatetracyclo[11.4.0.01,6.07,12]heptadeca-7,9,11-trien-3-one |
|---|---|
| PubChem CID | 7069204 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (1R,13S)-13-methyl-2,6-diazatetracyclo[11.4.0.01,6.07,12]heptadeca-7,9,11-trien-3-one |
| SMILES | C[C@@]12CCCC[C@]13NC(=O)CCN3c1ccccc12 |
| InChI | InChI=1S/C16H20N2O/c1-15-9-4-5-10-16(15)17-14(19)8-11-18(16)13-7-3-2-6-12(13)15/h2-3,6-7H,4-5,8-11H2,1H3,(H,17,19)/t15-,16+/m0/s1 |
| InChIKey | OFQFGAACEWFNCU-JKSUJKDBSA-N |
| XLogP | 2.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |