C28H36F2N6O6S — CID 70692083
2-[(1S,2S,3S,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]oxyethyl 2-methylpropyl carbonate (PubChem CID 70692083) has the molecular formula C28H36F2N6O6S and a molecular weight of 622.70 g/mol. Its IUPAC name is 2-[(1S,2S,3S,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]oxyethyl 2-methylpropyl carbonate.
| Compound Name | 2-[(1S,2S,3S,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]oxyethyl 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 70692083 |
| Molecular Formula | C28H36F2N6O6S |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | 2-[(1S,2S,3S,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]oxyethyl 2-methylpropyl carbonate |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@@H]3C[C@H](OCCOC(=O)OCC(C)C)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C28H36F2N6O6S/c1-4-9-43-27-32-25(31-19-11-16(19)15-5-6-17(29)18(30)10-15)22-26(33-27)36(35-34-22)20-12-21(24(38)23(20)37)40-7-8-41-28(39)42-13-14(2)3/h5-6,10,14,16,19-21,23-24,37-38H,4,7-9,11-13H2,1-3H3,(H,31,32,33)/t16-,19+,20+,21-,23-,24+/m0/s1 |
| InChIKey | UVGMWGVOLZFARX-MCHVBHGGSA-N |
| XLogP | 3.83 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|