C23H24O5 — CID 70692085
1,3,6-trihydroxy-2,5-bis(3-methylbut-2-enyl)xanthen-9-one (PubChem CID 70692085) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is 1,3,6-trihydroxy-2,5-bis(3-methylbut-2-enyl)xanthen-9-one.
| Compound Name | 1,3,6-trihydroxy-2,5-bis(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 70692085 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1,3,6-trihydroxy-2,5-bis(3-methylbut-2-enyl)xanthen-9-one |
| SMILES | CC(C)=CCc1c(O)cc2oc3c(CC=C(C)C)c(O)ccc3c(=O)c2c1O |
| InChI | InChI=1S/C23H24O5/c1-12(2)5-7-14-18(25)11-19-20(21(14)26)22(27)16-9-10-17(24)15(23(16)28-19)8-6-13(3)4/h5-6,9-11,24-26H,7-8H2,1-4H3 |
| InChIKey | RVOQPECMPLUENG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|