C29H34ClF2N5O — CID 70692197
[4-[2-(4-chloro-3-methylphenyl)-5-methyl-1,2,4-triazol-3-yl]piperidin-1-yl]-[(1R,2R,4R)-2-(2,4-difluorophenyl)-4-(dimethylamino)cyclopentyl]methanone (PubChem CID 70692197) has the molecular formula C29H34ClF2N5O and a molecular weight of 542.07 g/mol. Its IUPAC name is [4-[2-(4-chloro-3-methylphenyl)-5-methyl-1,2,4-triazol-3-yl]piperidin-1-yl]-[(1R,2R,4R)-2-(2,4-difluorophenyl)-4-(dimethylamino)cyclopentyl]methanone.
| Compound Name | [4-[2-(4-chloro-3-methylphenyl)-5-methyl-1,2,4-triazol-3-yl]piperidin-1-yl]-[(1R,2R,4R)-2-(2,4-difluorophenyl)-4-(dimethylamino)cyclopentyl]methanone |
|---|---|
| PubChem CID | 70692197 |
| Molecular Formula | C29H34ClF2N5O |
| Molecular Weight | 542.07 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | [4-[2-(4-chloro-3-methylphenyl)-5-methyl-1,2,4-triazol-3-yl]piperidin-1-yl]-[(1R,2R,4R)-2-(2,4-difluorophenyl)-4-(dimethylamino)cyclopentyl]methanone |
| SMILES | Cc1nc(C2CCN(C(=O)[C@@H]3C[C@H](N(C)C)C[C@H]3c3ccc(F)cc3F)CC2)n(-c2ccc(Cl)c(C)c2)n1 |
| InChI | InChI=1S/C29H34ClF2N5O/c1-17-13-21(6-8-26(17)30)37-28(33-18(2)34-37)19-9-11-36(12-10-19)29(38)25-16-22(35(3)4)15-24(25)23-7-5-20(31)14-27(23)32/h5-8,13-14,19,22,24-25H,9-12,15-16H2,1-4H3/t22-,24+,25-/m1/s1 |
| InChIKey | LFJIXCYCPAPDRN-PZUNEJSGSA-N |
| XLogP | 5.65 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.07 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |