C23H19F3N2O3S — CID 70692236
6-[2-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]-[1,3]oxazolo[5,4-b]pyridin-6-yl]hexanoic acid (PubChem CID 70692236) has the molecular formula C23H19F3N2O3S and a molecular weight of 460.48 g/mol. Its IUPAC name is 6-[2-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]-[1,3]oxazolo[5,4-b]pyridin-6-yl]hexanoic acid.
| Compound Name | 6-[2-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]-[1,3]oxazolo[5,4-b]pyridin-6-yl]hexanoic acid |
|---|---|
| PubChem CID | 70692236 |
| Molecular Formula | C23H19F3N2O3S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 6-[2-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]-[1,3]oxazolo[5,4-b]pyridin-6-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCc1cnc2oc(-c3cc(-c4ccccc4)c(C(F)(F)F)s3)nc2c1 |
| InChI | InChI=1S/C23H19F3N2O3S/c24-23(25,26)20-16(15-8-4-2-5-9-15)12-18(32-20)22-28-17-11-14(13-27-21(17)31-22)7-3-1-6-10-19(29)30/h2,4-5,8-9,11-13H,1,3,6-7,10H2,(H,29,30) |
| InChIKey | RCBLRDYHKFVCHI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|