C25H21F3N2O2S — CID 70692237
6-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-b]pyridin-6-yl]hexanoic acid (PubChem CID 70692237) has the molecular formula C25H21F3N2O2S and a molecular weight of 470.52 g/mol. Its IUPAC name is 6-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-b]pyridin-6-yl]hexanoic acid.
| Compound Name | 6-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-b]pyridin-6-yl]hexanoic acid |
|---|---|
| PubChem CID | 70692237 |
| Molecular Formula | C25H21F3N2O2S |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 6-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-b]pyridin-6-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCc1cnc2sc(-c3ccc(-c4ccccc4)c(C(F)(F)F)c3)nc2c1 |
| InChI | InChI=1S/C25H21F3N2O2S/c26-25(27,28)20-14-18(11-12-19(20)17-8-4-2-5-9-17)23-30-21-13-16(15-29-24(21)33-23)7-3-1-6-10-22(31)32/h2,4-5,8-9,11-15H,1,3,6-7,10H2,(H,31,32) |
| InChIKey | KHCLQBHPURUBGW-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|