C20H43NO2 — CID 70692304
(2S,3S,5S)-2-(dimethylamino)octadecane-3,5-diol (PubChem CID 70692304) has the molecular formula C20H43NO2 and a molecular weight of 329.57 g/mol. Its IUPAC name is (2S,3S,5S)-2-(dimethylamino)octadecane-3,5-diol.
| Compound Name | (2S,3S,5S)-2-(dimethylamino)octadecane-3,5-diol |
|---|---|
| PubChem CID | 70692304 |
| Molecular Formula | C20H43NO2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | (2S,3S,5S)-2-(dimethylamino)octadecane-3,5-diol |
| SMILES | CCCCCCCCCCCCC[C@H](O)C[C@H](O)[C@H](C)N(C)C |
| InChI | InChI=1S/C20H43NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-19(22)17-20(23)18(2)21(3)4/h18-20,22-23H,5-17H2,1-4H3/t18-,19-,20-/m0/s1 |
| InChIKey | JLNDROQZENXWHE-UFYCRDLUSA-N |
| XLogP | 4.75 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|