C20H41NO3 — CID 70692305
N-[(2S,3S,5S)-3,5-dihydroxyoctadecan-2-yl]acetamide (PubChem CID 70692305) has the molecular formula C20H41NO3 and a molecular weight of 343.55 g/mol. Its IUPAC name is N-[(2S,3S,5S)-3,5-dihydroxyoctadecan-2-yl]acetamide.
| Compound Name | N-[(2S,3S,5S)-3,5-dihydroxyoctadecan-2-yl]acetamide |
|---|---|
| PubChem CID | 70692305 |
| Molecular Formula | C20H41NO3 |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | N-[(2S,3S,5S)-3,5-dihydroxyoctadecan-2-yl]acetamide |
| SMILES | CCCCCCCCCCCCC[C@H](O)C[C@H](O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C20H41NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-19(23)16-20(24)17(2)21-18(3)22/h17,19-20,23-24H,4-16H2,1-3H3,(H,21,22)/t17-,19-,20-/m0/s1 |
| InChIKey | JBQVXCPCQLIHIG-IHPCNDPISA-N |
| XLogP | 4.32 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|