C23H32N6 — CID 70692345
1-[(4-aminocyclohexyl)methyl]-N-pentyl-3-phenylpyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 70692345) has the molecular formula C23H32N6 and a molecular weight of 392.55 g/mol. Its IUPAC name is 1-[(4-aminocyclohexyl)methyl]-N-pentyl-3-phenylpyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-[(4-aminocyclohexyl)methyl]-N-pentyl-3-phenylpyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 70692345 |
| Molecular Formula | C23H32N6 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 1-[(4-aminocyclohexyl)methyl]-N-pentyl-3-phenylpyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | CCCCCNc1ncc2c(-c3ccccc3)nn(CC3CCC(N)CC3)c2n1 |
| InChI | InChI=1S/C23H32N6/c1-2-3-7-14-25-23-26-15-20-21(18-8-5-4-6-9-18)28-29(22(20)27-23)16-17-10-12-19(24)13-11-17/h4-6,8-9,15,17,19H,2-3,7,10-14,16,24H2,1H3,(H,25,26,27) |
| InChIKey | JZBDNDJNPAVSSE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|