C14H13F2IN2O3 — CID 70692426
6-[(3,5-difluorophenyl)methyl]-1-(ethoxymethyl)-5-iodopyrimidine-2,4-dione (PubChem CID 70692426) has the molecular formula C14H13F2IN2O3 and a molecular weight of 422.17 g/mol. Its IUPAC name is 6-[(3,5-difluorophenyl)methyl]-1-(ethoxymethyl)-5-iodopyrimidine-2,4-dione.
| Compound Name | 6-[(3,5-difluorophenyl)methyl]-1-(ethoxymethyl)-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70692426 |
| Molecular Formula | C14H13F2IN2O3 |
| Molecular Weight | 422.17 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 6-[(3,5-difluorophenyl)methyl]-1-(ethoxymethyl)-5-iodopyrimidine-2,4-dione |
| SMILES | CCOCn1c(Cc2cc(F)cc(F)c2)c(I)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H13F2IN2O3/c1-2-22-7-19-11(12(17)13(20)18-14(19)21)5-8-3-9(15)6-10(16)4-8/h3-4,6H,2,5,7H2,1H3,(H,18,20,21) |
| InChIKey | BUUHDWKIYSNFDB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|