C21H21ClF2N4O5 — CID 70692477
1-[(Z)-1-[4-(3-chlorophenoxy)butoxy]-1-(2,4-difluorophenyl)prop-1-en-2-yl]-1,2,4-triazole;nitric acid (PubChem CID 70692477) has the molecular formula C21H21ClF2N4O5 and a molecular weight of 482.87 g/mol. Its IUPAC name is 1-[(Z)-1-[4-(3-chlorophenoxy)butoxy]-1-(2,4-difluorophenyl)prop-1-en-2-yl]-1,2,4-triazole;nitric acid.
| Compound Name | 1-[(Z)-1-[4-(3-chlorophenoxy)butoxy]-1-(2,4-difluorophenyl)prop-1-en-2-yl]-1,2,4-triazole;nitric acid |
|---|---|
| PubChem CID | 70692477 |
| Molecular Formula | C21H21ClF2N4O5 |
| Molecular Weight | 482.87 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 1-[(Z)-1-[4-(3-chlorophenoxy)butoxy]-1-(2,4-difluorophenyl)prop-1-en-2-yl]-1,2,4-triazole;nitric acid |
| SMILES | C/C(=C(/OCCCCOc1cccc(Cl)c1)c1ccc(F)cc1F)n1cncn1.O=[N+]([O-])O |
| InChI | InChI=1S/C21H20ClF2N3O2.HNO3/c1-15(27-14-25-13-26-27)21(19-8-7-17(23)12-20(19)24)29-10-3-2-9-28-18-6-4-5-16(22)11-18;2-1(3)4/h4-8,11-14H,2-3,9-10H2,1H3;(H,2,3,4)/b21-15-; |
| InChIKey | WEKDQIJFJODWRX-XGRJIHFXSA-N |
| XLogP | 5.08 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.87 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|