C29H35IN2O2 — CID 70692534
(2Z)-5-methoxy-2-[(2E,4E)-5-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-1,3,3-trimethylindole iodide (PubChem CID 70692534) has the molecular formula C29H35IN2O2 and a molecular weight of 570.52 g/mol. Its IUPAC name is (2Z)-5-methoxy-2-[(2E,4E)-5-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-1,3,3-trimethylindole iodide.
| Compound Name | (2Z)-5-methoxy-2-[(2E,4E)-5-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-1,3,3-trimethylindole iodide |
|---|---|
| PubChem CID | 70692534 |
| Molecular Formula | C29H35IN2O2 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | (2Z)-5-methoxy-2-[(2E,4E)-5-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-1,3,3-trimethylindole iodide |
| SMILES | COc1ccc2c(c1)C(C)(C)C(/C=C/C=C/C=C1\N(C)c3ccc(OC)cc3C1(C)C)=[N+]2C.[I-] |
| InChI | InChI=1S/C29H35N2O2.HI/c1-28(2)22-18-20(32-7)14-16-24(22)30(5)26(28)12-10-9-11-13-27-29(3,4)23-19-21(33-8)15-17-25(23)31(27)6;/h9-19H,1-8H3;1H/q+1;/p-1 |
| InChIKey | GRHCPAASZFEDFV-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 24.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|