C27H33NO4 — CID 70692544
[(5S,8R)-3,8-dimethyl-5-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-nitrobenzoate (PubChem CID 70692544) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is [(5S,8R)-3,8-dimethyl-5-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-nitrobenzoate.
| Compound Name | [(5S,8R)-3,8-dimethyl-5-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 70692544 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | [(5S,8R)-3,8-dimethyl-5-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-nitrobenzoate |
| SMILES | CC(C)=CCC[C@H](C)[C@@H]1CC[C@@H](C)c2c(OC(=O)c3ccc([N+](=O)[O-])cc3)cc(C)cc21 |
| InChI | InChI=1S/C27H33NO4/c1-17(2)7-6-8-19(4)23-14-9-20(5)26-24(23)15-18(3)16-25(26)32-27(29)21-10-12-22(13-11-21)28(30)31/h7,10-13,15-16,19-20,23H,6,8-9,14H2,1-5H3/t19-,20+,23-/m0/s1 |
| InChIKey | SOSJAEHGNQEDSZ-MZKRTTBSSA-N |
| XLogP | 7.49 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|