C23H25NO4 — CID 70692890
(2S,3R,4S,5R)-2-[1-[(4-cyclopropylphenyl)methyl]indol-3-yl]oxane-3,4,5-triol (PubChem CID 70692890) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[1-[(4-cyclopropylphenyl)methyl]indol-3-yl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[1-[(4-cyclopropylphenyl)methyl]indol-3-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70692890 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (2S,3R,4S,5R)-2-[1-[(4-cyclopropylphenyl)methyl]indol-3-yl]oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](c2cn(Cc3ccc(C4CC4)cc3)c3ccccc23)OC[C@H]1O |
| InChI | InChI=1S/C23H25NO4/c25-20-13-28-23(22(27)21(20)26)18-12-24(19-4-2-1-3-17(18)19)11-14-5-7-15(8-6-14)16-9-10-16/h1-8,12,16,20-23,25-27H,9-11,13H2/t20-,21+,22-,23+/m1/s1 |
| InChIKey | KWHMRNGXOWLPAR-ACESQOTJSA-N |
| XLogP | 2.72 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |