C24H27NO4 — CID 70692891
(2S,3R,4S,5R)-2-[1-[(4-cyclopropylphenyl)methyl]-7-methylindol-3-yl]oxane-3,4,5-triol (PubChem CID 70692891) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[1-[(4-cyclopropylphenyl)methyl]-7-methylindol-3-yl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[1-[(4-cyclopropylphenyl)methyl]-7-methylindol-3-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70692891 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (2S,3R,4S,5R)-2-[1-[(4-cyclopropylphenyl)methyl]-7-methylindol-3-yl]oxane-3,4,5-triol |
| SMILES | Cc1cccc2c([C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)cn(Cc3ccc(C4CC4)cc3)c12 |
| InChI | InChI=1S/C24H27NO4/c1-14-3-2-4-18-19(24-23(28)22(27)20(26)13-29-24)12-25(21(14)18)11-15-5-7-16(8-6-15)17-9-10-17/h2-8,12,17,20,22-24,26-28H,9-11,13H2,1H3/t20-,22+,23-,24+/m1/s1 |
| InChIKey | WNUKUQQCJQGENF-ONTLXTELSA-N |
| XLogP | 3.03 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |