About 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine
3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine (PubChem CID 70692897) has the molecular formula C21H35NO
and a molecular weight of 317.52 g/mol. Its IUPAC name is 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine.
Molecular Properties
| Compound Name | 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine |
| PubChem CID | 70692897 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine |
| SMILES | CCCCCCCC/C=C\c1c(C)cc(CCCOC)nc1C |
| InChI | InChI=1S/C21H35NO/c1-5-6-7-8-9-10-11-12-15-21-18(2)17-20(22-19(21)3)14-13-16-23-4/h12,15,17H,5-11,13-14,16H2,1-4H3/b15-12- |
| InChIKey | NVVNWMUZZOSCFN-QINSGFPZSA-N |
| XLogP | 6.04 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine?
The IUPAC name of 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine (CID 70692897) is 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine.
What is the SMILES notation for 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine?
The canonical SMILES for 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine is CCCCCCCC/C=C\c1c(C)cc(CCCOC)nc1C.
What is the InChIKey of 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine?
The InChIKey is NVVNWMUZZOSCFN-QINSGFPZSA-N. The full InChI is InChI=1S/C21H35NO/c1-5-6-7-8-9-10-11-12-15-21-18(2)17-20(22-19(21)3)14-13-16-23-4/h12,15,17H,5-11,13-14,16H2,1-4H3/b15-12-.
What are the key properties of 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine?
3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine has a molecular weight of 317.52 g/mol, XLogP of 6.04, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-dec-1-enyl]-6-(3-methoxypropyl)-2,4-dimethylpyridine is sourced from PubChem (CID 70692897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).