C36H46N4O10 — CID 70692933
5-[[5-(1-adamantylmethyl)-2-phenyl-1H-imidazole-4-carbonyl]amino]benzene-1,3-dicarboxylic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 70692933) has the molecular formula C36H46N4O10 and a molecular weight of 694.78 g/mol. Its IUPAC name is 5-[[5-(1-adamantylmethyl)-2-phenyl-1H-imidazole-4-carbonyl]amino]benzene-1,3-dicarboxylic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | 5-[[5-(1-adamantylmethyl)-2-phenyl-1H-imidazole-4-carbonyl]amino]benzene-1,3-dicarboxylic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 70692933 |
| Molecular Formula | C36H46N4O10 |
| Molecular Weight | 694.78 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | 5-[[5-(1-adamantylmethyl)-2-phenyl-1H-imidazole-4-carbonyl]amino]benzene-1,3-dicarboxylic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(O)c1cc(NC(=O)c2nc(-c3ccccc3)[nH]c2CC23CC4CC(CC(C4)C2)C3)cc(C(=O)O)c1 |
| InChI | InChI=1S/C29H29N3O5.C7H17NO5/c33-26(30-22-10-20(27(34)35)9-21(11-22)28(36)37)24-23(31-25(32-24)19-4-2-1-3-5-19)15-29-12-16-6-17(13-29)8-18(7-16)14-29;1-8-2-4(10)6(12)7(13)5(11)3-9/h1-5,9-11,16-18H,6-8,12-15H2,(H,30,33)(H,31,32)(H,34,35)(H,36,37);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | GCRRWQHFOIIPRF-WZTVWXICSA-N |
| XLogP | 2.13 |
| TPSA | 245.56 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.78 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |