About 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile
2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile (PubChem CID 70693035) has the molecular formula C21H21F3N4O
and a molecular weight of 402.42 g/mol. Its IUPAC name is 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile |
| PubChem CID | 70693035 |
| Molecular Formula | C21H21F3N4O |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1CCN(C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C21H21F3N4O/c22-17-12-19(24)18(23)10-15(17)9-16(26)11-21(29)28-7-5-27(6-8-28)20-4-2-1-3-14(20)13-25/h1-4,10,12,16H,5-9,11,26H2/t16-/m1/s1 |
| InChIKey | LTYBWJDVOQLBCU-MRXNPFEDSA-N |
| XLogP | 2.58 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile?
The IUPAC name of 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile (CID 70693035) is 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile.
What is the SMILES notation for 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile?
The canonical SMILES for 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile is N#Cc1ccccc1N1CCN(C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)CC1.
What is the InChIKey of 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile?
The InChIKey is LTYBWJDVOQLBCU-MRXNPFEDSA-N. The full InChI is InChI=1S/C21H21F3N4O/c22-17-12-19(24)18(23)10-15(17)9-16(26)11-21(29)28-7-5-27(6-8-28)20-4-2-1-3-14(20)13-25/h1-4,10,12,16H,5-9,11,26H2/t16-/m1/s1.
What are the key properties of 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile?
2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile has a molecular weight of 402.42 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile is sourced from PubChem (CID 70693035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).