C20H21F3N4O3 — CID 70693037
5-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 70693037) has the molecular formula C20H21F3N4O3 and a molecular weight of 422.41 g/mol. Its IUPAC name is 5-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 5-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 70693037 |
| Molecular Formula | C20H21F3N4O3 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 5-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | N[C@@H](CC(=O)N1CCN(C(=O)c2ccc(=O)[nH]c2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H21F3N4O3/c21-15-10-17(23)16(22)8-13(15)7-14(24)9-19(29)26-3-5-27(6-4-26)20(30)12-1-2-18(28)25-11-12/h1-2,8,10-11,14H,3-7,9,24H2,(H,25,28)/t14-/m1/s1 |
| InChIKey | ZTRSDLKYDRFWKC-CQSZACIVSA-N |
| XLogP | 1.04 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|