C24H25F3N4O2 — CID 70693038
(3R)-3-amino-1-[4-(1-methylindole-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 70693038) has the molecular formula C24H25F3N4O2 and a molecular weight of 458.48 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-(1-methylindole-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[4-(1-methylindole-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 70693038 |
| Molecular Formula | C24H25F3N4O2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | (3R)-3-amino-1-[4-(1-methylindole-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | Cn1c(C(=O)N2CCN(C(=O)C[C@H](N)Cc3cc(F)c(F)cc3F)CC2)cc2ccccc21 |
| InChI | InChI=1S/C24H25F3N4O2/c1-29-21-5-3-2-4-15(21)12-22(29)24(33)31-8-6-30(7-9-31)23(32)13-17(28)10-16-11-19(26)20(27)14-18(16)25/h2-5,11-12,14,17H,6-10,13,28H2,1H3/t17-/m1/s1 |
| InChIKey | PGJBNBOMGATLCI-QGZVFWFLSA-N |
| XLogP | 2.84 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|