C23H22F3N5O2 — CID 70693040
(3R)-3-amino-1-[4-(1,8-naphthyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 70693040) has the molecular formula C23H22F3N5O2 and a molecular weight of 457.46 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-(1,8-naphthyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[4-(1,8-naphthyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 70693040 |
| Molecular Formula | C23H22F3N5O2 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (3R)-3-amino-1-[4-(1,8-naphthyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCN(C(=O)c2ccc3cccnc3n2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H22F3N5O2/c24-17-13-19(26)18(25)11-15(17)10-16(27)12-21(32)30-6-8-31(9-7-30)23(33)20-4-3-14-2-1-5-28-22(14)29-20/h1-5,11,13,16H,6-10,12,27H2/t16-/m1/s1 |
| InChIKey | HCHGXASNLUUZHY-MRXNPFEDSA-N |
| XLogP | 2.29 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|