C20H39ClN10 — CID 70693086
13,26-dimethyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(27),11,14(28),24-tetraene;hydrochloride (PubChem CID 70693086) has the molecular formula C20H39ClN10 and a molecular weight of 455.06 g/mol. Its IUPAC name is 13,26-dimethyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(27),11,14(28),24-tetraene;hydrochloride.
| Compound Name | 13,26-dimethyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(27),11,14(28),24-tetraene;hydrochloride |
|---|---|
| PubChem CID | 70693086 |
| Molecular Formula | C20H39ClN10 |
| Molecular Weight | 455.06 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | 13,26-dimethyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(27),11,14(28),24-tetraene;hydrochloride |
| SMILES | Cl.Cn1nc2cc1CNCCNCCNCc1cc(n(C)n1)CNCCNCCNC2 |
| InChI | InChI=1S/C20H38N10.ClH/c1-29-19-11-17(27-29)13-23-7-3-22-6-10-26-16-20-12-18(28-30(20)2)14-24-8-4-21-5-9-25-15-19;/h11-12,21-26H,3-10,13-16H2,1-2H3;1H |
| InChIKey | KBJTZDLQPLAXLG-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.06 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |