C32H47ClN10 — CID 70693088
13,26-dibenzyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(27),11,14(28),24-tetraene;hydrochloride (PubChem CID 70693088) has the molecular formula C32H47ClN10 and a molecular weight of 607.25 g/mol. Its IUPAC name is 13,26-dibenzyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(27),11,14(28),24-tetraene;hydrochloride.
| Compound Name | 13,26-dibenzyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(27),11,14(28),24-tetraene;hydrochloride |
|---|---|
| PubChem CID | 70693088 |
| Molecular Formula | C32H47ClN10 |
| Molecular Weight | 607.25 g/mol |
| Exact Mass | 606.37 |
| IUPAC Name | 13,26-dibenzyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(27),11,14(28),24-tetraene;hydrochloride |
| SMILES | Cl.c1ccc(Cn2nc3cc2CNCCNCCNCc2cc(n(Cc4ccccc4)n2)CNCCNCCNC3)cc1 |
| InChI | InChI=1S/C32H46N10.ClH/c1-3-7-27(8-4-1)25-41-31-19-29(39-41)21-35-15-11-34-14-18-38-24-32-20-30(22-36-16-12-33-13-17-37-23-31)40-42(32)26-28-9-5-2-6-10-28;/h1-10,19-20,33-38H,11-18,21-26H2;1H |
| InChIKey | YOUJLZCXQORJRW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |