C21H30O4 — CID 70693127
(1S,7S,9S)-5,5-dimethyl-12-(3-methylpentoxy)-10-oxo-11-oxatetracyclo[7.3.1.01,9.03,7]tridec-2-ene-2-carbaldehyde (PubChem CID 70693127) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1S,7S,9S)-5,5-dimethyl-12-(3-methylpentoxy)-10-oxo-11-oxatetracyclo[7.3.1.01,9.03,7]tridec-2-ene-2-carbaldehyde.
| Compound Name | (1S,7S,9S)-5,5-dimethyl-12-(3-methylpentoxy)-10-oxo-11-oxatetracyclo[7.3.1.01,9.03,7]tridec-2-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 70693127 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (1S,7S,9S)-5,5-dimethyl-12-(3-methylpentoxy)-10-oxo-11-oxatetracyclo[7.3.1.01,9.03,7]tridec-2-ene-2-carbaldehyde |
| SMILES | CCC(C)CCOC1OC(=O)[C@]23C[C@@H]4CC(C)(C)CC4=C(C=O)[C@]12C3 |
| InChI | InChI=1S/C21H30O4/c1-5-13(2)6-7-24-18-21-12-20(21,17(23)25-18)9-14-8-19(3,4)10-15(14)16(21)11-22/h11,13-14,18H,5-10,12H2,1-4H3/t13?,14-,18?,20+,21+/m0/s1 |
| InChIKey | CERWTWXWRVGAAK-PBGUIJGPSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|