C19H21F3O3 — CID 70693192
4-hydroxy-3-[(2R)-8,8,8-trifluoro-2-methyloctyl]naphthalene-1,2-dione (PubChem CID 70693192) has the molecular formula C19H21F3O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 4-hydroxy-3-[(2R)-8,8,8-trifluoro-2-methyloctyl]naphthalene-1,2-dione.
| Compound Name | 4-hydroxy-3-[(2R)-8,8,8-trifluoro-2-methyloctyl]naphthalene-1,2-dione |
|---|---|
| PubChem CID | 70693192 |
| Molecular Formula | C19H21F3O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-hydroxy-3-[(2R)-8,8,8-trifluoro-2-methyloctyl]naphthalene-1,2-dione |
| SMILES | C[C@H](CCCCCC(F)(F)F)CC1=C(O)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C19H21F3O3/c1-12(7-3-2-6-10-19(20,21)22)11-15-16(23)13-8-4-5-9-14(13)17(24)18(15)25/h4-5,8-9,12,23H,2-3,6-7,10-11H2,1H3/t12-/m1/s1 |
| InChIKey | UETSDKKXENTUFH-GFCCVEGCSA-N |
| XLogP | 5.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|