About 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione
1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione (PubChem CID 70693292) has the molecular formula C15H16N4O3
and a molecular weight of 300.32 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione.
Molecular Properties
| Compound Name | 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione |
| PubChem CID | 70693292 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(COc3ccccc3)n2C)n(C)c1=O |
| InChI | InChI=1S/C15H16N4O3/c1-17-11(9-22-10-7-5-4-6-8-10)16-13-12(17)14(20)19(3)15(21)18(13)2/h4-8H,9H2,1-3H3 |
| InChIKey | ZMYAPXMDMKEKHX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione?
The IUPAC name of 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione (CID 70693292) is 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione.
What is the SMILES notation for 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione?
The canonical SMILES for 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione is Cn1c(=O)c2c(nc(COc3ccccc3)n2C)n(C)c1=O.
What is the InChIKey of 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione?
The InChIKey is ZMYAPXMDMKEKHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O3/c1-17-11(9-22-10-7-5-4-6-8-10)16-13-12(17)14(20)19(3)15(21)18(13)2/h4-8H,9H2,1-3H3.
What are the key properties of 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione?
1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione has a molecular weight of 300.32 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,7-trimethyl-8-(phenoxymethyl)purine-2,6-dione is sourced from PubChem (CID 70693292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).